C9H18N2O — CID 90770632
1,2,2,4-tetramethyl-1,4-diazepan-5-one (PubChem CID 90770632) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1,2,2,4-tetramethyl-1,4-diazepan-5-one.
| Compound Name | 1,2,2,4-tetramethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 90770632 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1,2,2,4-tetramethyl-1,4-diazepan-5-one |
| SMILES | CN1CC(C)(C)N(C)CCC1=O |
| InChI | InChI=1S/C9H18N2O/c1-9(2)7-10(3)8(12)5-6-11(9)4/h5-7H2,1-4H3 |
| InChIKey | HPLXUMNEBPOWGW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |