C13H21N — CID 90771096
3-ethyl-2,8,9-trimethyl-5,6-dihydro-4H-azonine (PubChem CID 90771096) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-ethyl-2,8,9-trimethyl-5,6-dihydro-4H-azonine.
| Compound Name | 3-ethyl-2,8,9-trimethyl-5,6-dihydro-4H-azonine |
|---|---|
| PubChem CID | 90771096 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-ethyl-2,8,9-trimethyl-5,6-dihydro-4H-azonine |
| SMILES | CCC1=C(C)/N=C(/C)C(C)=CCCC1 |
| InChI | InChI=1S/C13H21N/c1-5-13-9-7-6-8-10(2)11(3)14-12(13)4/h8H,5-7,9H2,1-4H3/b10-8?,13-12?,14-11- |
| InChIKey | YDBZZZIREZIOIX-CIMDKVEPSA-N |
| XLogP | 4.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |