C31H40N6O2 — CID 90771440
4-[4-(5-cyano-1H-indol-3-yl)butyl]-N-[4-methoxy-3-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide (PubChem CID 90771440) has the molecular formula C31H40N6O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 4-[4-(5-cyano-1H-indol-3-yl)butyl]-N-[4-methoxy-3-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-(5-cyano-1H-indol-3-yl)butyl]-N-[4-methoxy-3-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90771440 |
| Molecular Formula | C31H40N6O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 4-[4-(5-cyano-1H-indol-3-yl)butyl]-N-[4-methoxy-3-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(CCCCc3c[nH]c4ccc(C#N)cc34)CC2)cc1N1CCC(C)CC1 |
| InChI | InChI=1S/C31H40N6O2/c1-23-10-13-36(14-11-23)29-20-26(7-9-30(29)39-2)34-31(38)37-17-15-35(16-18-37)12-4-3-5-25-22-33-28-8-6-24(21-32)19-27(25)28/h6-9,19-20,22-23,33H,3-5,10-18H2,1-2H3,(H,34,38) |
| InChIKey | QTGWYIQJSLFJRO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|