C17H33ClN2O2 — CID 90771883
1-[(4-amino-4-hydroxybutan-2-yl)-(5-methylhex-1-en-2-yl)amino]-2-(2-chloroethyl)but-3-en-1-ol (PubChem CID 90771883) has the molecular formula C17H33ClN2O2 and a molecular weight of 332.92 g/mol. Its IUPAC name is 1-[(4-amino-4-hydroxybutan-2-yl)-(5-methylhex-1-en-2-yl)amino]-2-(2-chloroethyl)but-3-en-1-ol.
| Compound Name | 1-[(4-amino-4-hydroxybutan-2-yl)-(5-methylhex-1-en-2-yl)amino]-2-(2-chloroethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 90771883 |
| Molecular Formula | C17H33ClN2O2 |
| Molecular Weight | 332.92 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[(4-amino-4-hydroxybutan-2-yl)-(5-methylhex-1-en-2-yl)amino]-2-(2-chloroethyl)but-3-en-1-ol |
| SMILES | C=CC(CCCl)C(O)N(C(=C)CCC(C)C)C(C)CC(N)O |
| InChI | InChI=1S/C17H33ClN2O2/c1-6-15(9-10-18)17(22)20(14(5)11-16(19)21)13(4)8-7-12(2)3/h6,12,14-17,21-22H,1,4,7-11,19H2,2-3,5H3 |
| InChIKey | BKIRIFGFGHMQTB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|