C20H14BrN3O2 — CID 90772893
4-(3-bromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile (PubChem CID 90772893) has the molecular formula C20H14BrN3O2 and a molecular weight of 408.26 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile.
| Compound Name | 4-(3-bromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 90772893 |
| Molecular Formula | C20H14BrN3O2 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 4-(3-bromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(c(=O)n(C)c3ccccc23)C(c2cccc(Br)c2)C1C#N |
| InChI | InChI=1S/C20H14BrN3O2/c1-24-15-8-3-2-7-13(15)18-17(20(24)25)16(14(10-22)19(23)26-18)11-5-4-6-12(21)9-11/h2-9,14,16,23H,1H3/b23-19- |
| InChIKey | OZWUUWZXGTXDMN-NMWGTECJSA-N |
| XLogP | 3.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|