C13H26O5 — CID 90772896
3,3-dimethyl-1,4,7,10,13-pentaoxacyclohexadecane (PubChem CID 90772896) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3,3-dimethyl-1,4,7,10,13-pentaoxacyclohexadecane.
| Compound Name | 3,3-dimethyl-1,4,7,10,13-pentaoxacyclohexadecane |
|---|---|
| PubChem CID | 90772896 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3,3-dimethyl-1,4,7,10,13-pentaoxacyclohexadecane |
| SMILES | CC1(C)COCCCOCCOCCOCCO1 |
| InChI | InChI=1S/C13H26O5/c1-13(2)12-17-5-3-4-14-6-7-15-8-9-16-10-11-18-13/h3-12H2,1-2H3 |
| InChIKey | KCSRBSBYULRCBA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |