C19H23N3O2S — CID 90773157
1-[(1,2-dioxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-3-yl)amino]-3-phenylthiourea (PubChem CID 90773157) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[(1,2-dioxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-3-yl)amino]-3-phenylthiourea.
| Compound Name | 1-[(1,2-dioxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-3-yl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 90773157 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[(1,2-dioxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-3-yl)amino]-3-phenylthiourea |
| SMILES | O=C1C(=O)C2C(NNC(=S)Nc3ccccc3)CCC3CCCC1C32 |
| InChI | InChI=1S/C19H23N3O2S/c23-17-13-8-4-5-11-9-10-14(16(15(11)13)18(17)24)21-22-19(25)20-12-6-2-1-3-7-12/h1-3,6-7,11,13-16,21H,4-5,8-10H2,(H2,20,22,25) |
| InChIKey | NQVHAEYDTWVHHK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|