About tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane
tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane (PubChem CID 90773968) has the molecular formula C22H30N2O2S
and a molecular weight of 386.56 g/mol. Its IUPAC name is tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane |
| PubChem CID | 90773968 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)Nc1cc2ccccc2cc1-c1cncs1 |
| InChI | InChI=1S/C18H18N2O2S.2C2H6/c1-18(2,3)22-17(21)20-15-9-13-7-5-4-6-12(13)8-14(15)16-10-19-11-23-16;2*1-2/h4-11H,1-3H3,(H,20,21);2*1-2H3 |
| InChIKey | PXMKAJGBOQZODT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane?
The IUPAC name of tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane (CID 90773968) is tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane?
The canonical SMILES for tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane is CC.CC.CC(C)(C)OC(=O)Nc1cc2ccccc2cc1-c1cncs1.
What is the InChIKey of tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane?
The InChIKey is PXMKAJGBOQZODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2S.2C2H6/c1-18(2,3)22-17(21)20-15-9-13-7-5-4-6-12(13)8-14(15)16-10-19-11-23-16;2*1-2/h4-11H,1-3H3,(H,20,21);2*1-2H3.
What are the key properties of tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane?
tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane has a molecular weight of 386.56 g/mol, XLogP of 7.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-(1,3-thiazol-5-yl)naphthalen-2-yl]carbamate;ethane is sourced from PubChem (CID 90773968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).