C28H27N3O — CID 90773999
[6-(3-cyanophenyl)-1'-(2-methylpentanoyl)spiro[3H-indene-2,4'-cyclohexene]-1-ylidene]cyanamide (PubChem CID 90773999) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is [6-(3-cyanophenyl)-1'-(2-methylpentanoyl)spiro[3H-indene-2,4'-cyclohexene]-1-ylidene]cyanamide.
| Compound Name | [6-(3-cyanophenyl)-1'-(2-methylpentanoyl)spiro[3H-indene-2,4'-cyclohexene]-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 90773999 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | [6-(3-cyanophenyl)-1'-(2-methylpentanoyl)spiro[3H-indene-2,4'-cyclohexene]-1-ylidene]cyanamide |
| SMILES | CCCC(C)C(=O)C1=CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1/C2=N\C#N |
| InChI | InChI=1S/C28H27N3O/c1-3-5-19(2)26(32)21-10-12-28(13-11-21)16-24-9-8-23(15-25(24)27(28)31-18-30)22-7-4-6-20(14-22)17-29/h4,6-10,14-15,19H,3,5,11-13,16H2,1-2H3/b31-27+ |
| InChIKey | ITNUNULKSHWCHM-TVKQRKNISA-N |
| XLogP | 6.15 |
| TPSA | 77.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|