C34H31FNO3- — CID 90774200
1-[4-benzyl-2-[[4-(4-fluorophenoxy)phenyl]carbamoyl]cyclopentylidene]-2-phenylpropan-1-olate (PubChem CID 90774200) has the molecular formula C34H31FNO3- and a molecular weight of 520.62 g/mol. Its IUPAC name is 1-[4-benzyl-2-[[4-(4-fluorophenoxy)phenyl]carbamoyl]cyclopentylidene]-2-phenylpropan-1-olate.
| Compound Name | 1-[4-benzyl-2-[[4-(4-fluorophenoxy)phenyl]carbamoyl]cyclopentylidene]-2-phenylpropan-1-olate |
|---|---|
| PubChem CID | 90774200 |
| Molecular Formula | C34H31FNO3- |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 1-[4-benzyl-2-[[4-(4-fluorophenoxy)phenyl]carbamoyl]cyclopentylidene]-2-phenylpropan-1-olate |
| SMILES | CC(C([O-])=C1CC(Cc2ccccc2)CC1C(=O)Nc1ccc(Oc2ccc(F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H32FNO3/c1-23(26-10-6-3-7-11-26)33(37)31-21-25(20-24-8-4-2-5-9-24)22-32(31)34(38)36-28-14-18-30(19-15-28)39-29-16-12-27(35)13-17-29/h2-19,23,25,32,37H,20-22H2,1H3,(H,36,38)/p-1 |
| InChIKey | TZVJSLYVRRVBPJ-UHFFFAOYSA-M |
| XLogP | 7.24 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|