About 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol
1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol (PubChem CID 90775006) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol |
| PubChem CID | 90775006 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol |
| SMILES | CNn1c(O)cc(NC(C)C)c1O |
| InChI | InChI=1S/C8H15N3O2/c1-5(2)10-6-4-7(12)11(9-3)8(6)13/h4-5,9-10,12-13H,1-3H3 |
| InChIKey | WTOUVRGMSJDECW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol?
The IUPAC name of 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol (CID 90775006) is 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol.
What is the SMILES notation for 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol?
The canonical SMILES for 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol is CNn1c(O)cc(NC(C)C)c1O.
What is the InChIKey of 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol?
The InChIKey is WTOUVRGMSJDECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-5(2)10-6-4-7(12)11(9-3)8(6)13/h4-5,9-10,12-13H,1-3H3.
What are the key properties of 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol?
1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol has a molecular weight of 185.23 g/mol, XLogP of 0.89, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)-3-(propan-2-ylamino)pyrrole-2,5-diol is sourced from PubChem (CID 90775006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).