C21H23NO3S — CID 90775052
8-methoxy-6-(3-methylsulfinylphenyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 90775052) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 8-methoxy-6-(3-methylsulfinylphenyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 8-methoxy-6-(3-methylsulfinylphenyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 90775052 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 8-methoxy-6-(3-methylsulfinylphenyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | COc1ccc2c(c1)C(c1cccc(S(C)=O)c1)=NC1CCC(O)CC21 |
| InChI | InChI=1S/C21H23NO3S/c1-25-15-7-8-17-18-11-14(23)6-9-20(18)22-21(19(17)12-15)13-4-3-5-16(10-13)26(2)24/h3-5,7-8,10,12,14,18,20,23H,6,9,11H2,1-2H3 |
| InChIKey | HWXGMEZAYIYTJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |