About 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine
1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine (PubChem CID 90775473) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine.
Analyze 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine?
The IUPAC name of 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine (CID 90775473) is 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine.
What is the SMILES notation for 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine?
The canonical SMILES for 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine is CCC1=C(C)C(C)CC(C)(C)N1CC.
What is the InChIKey of 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine?
The InChIKey is ZRGGCYOPYCLDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-7-12-11(4)10(3)9-13(5,6)14(12)8-2/h10H,7-9H2,1-6H3.
What are the key properties of 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine?
1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine has a molecular weight of 195.35 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diethyl-2,2,4,5-tetramethyl-3,4-dihydropyridine is sourced from PubChem (CID 90775473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).