About 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile
4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile (PubChem CID 90775837) has the molecular formula C27H19N3O
and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile |
| PubChem CID | 90775837 |
| Molecular Formula | C27H19N3O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2ccc(N(C3=CCCC=C3)c3ccc(C=O)cc3)cc2)cc1C#N |
| InChI | InChI=1S/C27H19N3O/c28-17-23-9-8-22(16-24(23)18-29)21-10-14-27(15-11-21)30(25-4-2-1-3-5-25)26-12-6-20(19-31)7-13-26/h2,4-16,19H,1,3H2 |
| InChIKey | VWNLIVKIRXODCD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile?
The IUPAC name of 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile (CID 90775837) is 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile is N#Cc1ccc(-c2ccc(N(C3=CCCC=C3)c3ccc(C=O)cc3)cc2)cc1C#N.
What is the InChIKey of 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile?
The InChIKey is VWNLIVKIRXODCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19N3O/c28-17-23-9-8-22(16-24(23)18-29)21-10-14-27(15-11-21)30(25-4-2-1-3-5-25)26-12-6-20(19-31)7-13-26/h2,4-16,19H,1,3H2.
What are the key properties of 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile?
4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile has a molecular weight of 401.47 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(N-cyclohexa-1,5-dien-1-yl-4-formylanilino)phenyl]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 90775837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).