About 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid
2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid (PubChem CID 90776140) has the molecular formula C7H8Br2N2O2
and a molecular weight of 311.96 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid |
| PubChem CID | 90776140 |
| Molecular Formula | C7H8Br2N2O2 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid |
| SMILES | CN1C(C(=O)O)=C(Br)C=C(Br)C1N |
| InChI | InChI=1S/C7H8Br2N2O2/c1-11-5(7(12)13)3(8)2-4(9)6(11)10/h2,6H,10H2,1H3,(H,12,13) |
| InChIKey | OZHZWHWLRDULCT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid?
The IUPAC name of 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid (CID 90776140) is 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid.
What is the SMILES notation for 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid?
The canonical SMILES for 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid is CN1C(C(=O)O)=C(Br)C=C(Br)C1N.
What is the InChIKey of 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid?
The InChIKey is OZHZWHWLRDULCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Br2N2O2/c1-11-5(7(12)13)3(8)2-4(9)6(11)10/h2,6H,10H2,1H3,(H,12,13).
What are the key properties of 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid?
2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid has a molecular weight of 311.96 g/mol, XLogP of 1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,5-dibromo-1-methyl-2H-pyridine-6-carboxylic acid is sourced from PubChem (CID 90776140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).