C21H14F6O2 — CID 90776291
(1E,6E)-1,7-bis[4-(trifluoromethyl)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 90776291) has the molecular formula C21H14F6O2 and a molecular weight of 412.33 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[4-(trifluoromethyl)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[4-(trifluoromethyl)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 90776291 |
| Molecular Formula | C21H14F6O2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (1E,6E)-1,7-bis[4-(trifluoromethyl)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)CC(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H14F6O2/c22-20(23,24)16-7-1-14(2-8-16)5-11-18(28)13-19(29)12-6-15-3-9-17(10-4-15)21(25,26)27/h1-12H,13H2/b11-5+,12-6+ |
| InChIKey | GJGHGKMVJJXPQE-YDWXAUTNSA-N |
| XLogP | 5.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|