About 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide
2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide (PubChem CID 90776585) has the molecular formula C21H17F3N2O3
and a molecular weight of 402.37 g/mol. Its IUPAC name is 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide |
| PubChem CID | 90776585 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2cc(C(=O)NCC(O)c3cccc(C(F)(F)F)c3)ccc2c1 |
| InChI | InChI=1S/C21H17F3N2O3/c22-21(23,24)17-3-1-2-14(10-17)18(27)11-26-20(29)16-7-5-12-8-15(19(25)28)6-4-13(12)9-16/h1-10,18,27H,11H2,(H2,25,28)(H,26,29) |
| InChIKey | UICHBFMQYAYFHL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide?
The IUPAC name of 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide (CID 90776585) is 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide.
What is the SMILES notation for 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide?
The canonical SMILES for 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide is NC(=O)c1ccc2cc(C(=O)NCC(O)c3cccc(C(F)(F)F)c3)ccc2c1.
What is the InChIKey of 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide?
The InChIKey is UICHBFMQYAYFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F3N2O3/c22-21(23,24)17-3-1-2-14(10-17)18(27)11-26-20(29)16-7-5-12-8-15(19(25)28)6-4-13(12)9-16/h1-10,18,27H,11H2,(H2,25,28)(H,26,29).
What are the key properties of 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide?
2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide has a molecular weight of 402.37 g/mol, XLogP of 3.42, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-2,6-dicarboxamide is sourced from PubChem (CID 90776585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).