About 4-amino-1,3-difluorobutan-2-ol
4-amino-1,3-difluorobutan-2-ol (PubChem CID 90776814) has the molecular formula C4H9F2NO
and a molecular weight of 125.12 g/mol. Its IUPAC name is 4-amino-1,3-difluorobutan-2-ol.
Molecular Properties
| Compound Name | 4-amino-1,3-difluorobutan-2-ol |
| PubChem CID | 90776814 |
| Molecular Formula | C4H9F2NO |
| Molecular Weight | 125.12 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | 4-amino-1,3-difluorobutan-2-ol |
| SMILES | NCC(F)C(O)CF |
| InChI | InChI=1S/C4H9F2NO/c5-1-4(8)3(6)2-7/h3-4,8H,1-2,7H2 |
| InChIKey | VHGRCTCXCJSXRE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.12 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-1,3-difluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-difluorobutan-2-ol?
The IUPAC name of 4-amino-1,3-difluorobutan-2-ol (CID 90776814) is 4-amino-1,3-difluorobutan-2-ol.
What is the SMILES notation for 4-amino-1,3-difluorobutan-2-ol?
The canonical SMILES for 4-amino-1,3-difluorobutan-2-ol is NCC(F)C(O)CF.
What is the InChIKey of 4-amino-1,3-difluorobutan-2-ol?
The InChIKey is VHGRCTCXCJSXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F2NO/c5-1-4(8)3(6)2-7/h3-4,8H,1-2,7H2.
What are the key properties of 4-amino-1,3-difluorobutan-2-ol?
4-amino-1,3-difluorobutan-2-ol has a molecular weight of 125.12 g/mol, XLogP of -0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-difluorobutan-2-ol is sourced from PubChem (CID 90776814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).