C6H10N2 — CID 90776816
3-ethenyl-2-methyl-2,4-dihydroimidazole (PubChem CID 90776816) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-ethenyl-2-methyl-2,4-dihydroimidazole.
| Compound Name | 3-ethenyl-2-methyl-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 90776816 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 3-ethenyl-2-methyl-2,4-dihydroimidazole |
| SMILES | C=CN1CC=NC1C |
| InChI | InChI=1S/C6H10N2/c1-3-8-5-4-7-6(8)2/h3-4,6H,1,5H2,2H3 |
| InChIKey | WUEJLXAOOSVDHD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |