C9H8BrN3 — CID 90776952
3-bromo-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene (PubChem CID 90776952) has the molecular formula C9H8BrN3 and a molecular weight of 238.09 g/mol. Its IUPAC name is 3-bromo-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene.
| Compound Name | 3-bromo-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene |
|---|---|
| PubChem CID | 90776952 |
| Molecular Formula | C9H8BrN3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 3-bromo-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene |
| SMILES | Brc1[nH]nc2ncc3c(c12)CCC3 |
| InChI | InChI=1S/C9H8BrN3/c10-8-7-6-3-1-2-5(6)4-11-9(7)13-12-8/h4H,1-3H2,(H,11,12,13) |
| InChIKey | NTBQKLFVSVFQRS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |