C19H34O3 — CID 90777022
1-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol (PubChem CID 90777022) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol.
| Compound Name | 1-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 90777022 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 1-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol |
| SMILES | CCC1CC(CC(C)O)OC(C2CCC3CCCCC3C2)O1 |
| InChI | InChI=1S/C19H34O3/c1-3-17-12-18(10-13(2)20)22-19(21-17)16-9-8-14-6-4-5-7-15(14)11-16/h13-20H,3-12H2,1-2H3 |
| InChIKey | OZTCOCNYNQDKFY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |