C24H36FNO5 — CID 90777074
7-[(1R,2R,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid (PubChem CID 90777074) has the molecular formula C24H36FNO5 and a molecular weight of 437.55 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 90777074 |
| Molecular Formula | C24H36FNO5 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid |
| SMILES | O=NC1C[C@H](O)[C@H](CCCCCCC(=O)O)[C@H]1CC[C@@H](O)CCCc1ccccc1F |
| InChI | InChI=1S/C24H36FNO5/c25-21-12-6-5-8-17(21)9-7-10-18(27)14-15-19-20(23(28)16-22(19)26-31)11-3-1-2-4-13-24(29)30/h5-6,8,12,18-20,22-23,27-28H,1-4,7,9-11,13-16H2,(H,29,30)/t18-,19+,20+,22?,23-/m0/s1 |
| InChIKey | GSTDIKXSUZNYMM-GFPULUNBSA-N |
| XLogP | 4.85 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|