C22H33N3O3 — CID 90777613
tert-butyl N-[1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamate (PubChem CID 90777613) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamate |
|---|---|
| PubChem CID | 90777613 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | tert-butyl N-[1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamate |
| SMILES | CCCCCCC(NC(=O)OC(C)(C)C)c1ncc(-c2ccccc2OC)[nH]1 |
| InChI | InChI=1S/C22H33N3O3/c1-6-7-8-9-13-17(25-21(26)28-22(2,3)4)20-23-15-18(24-20)16-12-10-11-14-19(16)27-5/h10-12,14-15,17H,6-9,13H2,1-5H3,(H,23,24)(H,25,26) |
| InChIKey | PMUCPFIIYSWLFG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|