C24H31NO7 — CID 90778201
4-[(4S,10S)-10,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),5,12,14,16-pentaen-15-yl]butyl N-methylcarbamate (PubChem CID 90778201) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[(4S,10S)-10,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),5,12,14,16-pentaen-15-yl]butyl N-methylcarbamate.
| Compound Name | 4-[(4S,10S)-10,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),5,12,14,16-pentaen-15-yl]butyl N-methylcarbamate |
|---|---|
| PubChem CID | 90778201 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[(4S,10S)-10,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),5,12,14,16-pentaen-15-yl]butyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCCc1ccc(O)c2c1C=CC[C@H](O)CC(=O)CC=C[C@H](C)OC2=O |
| InChI | InChI=1S/C24H31NO7/c1-16-7-5-9-18(26)15-19(27)10-6-11-20-17(8-3-4-14-31-24(30)25-2)12-13-21(28)22(20)23(29)32-16/h5-7,11-13,16,19,27-28H,3-4,8-10,14-15H2,1-2H3,(H,25,30)/t16-,19-/m0/s1 |
| InChIKey | CGQVNJBGPWEVER-LPHOPBHVSA-N |
| XLogP | 3.30 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|