About ethane;3-methyl-1,3-thiazolidin-2-one
ethane;3-methyl-1,3-thiazolidin-2-one (PubChem CID 90778752) has the molecular formula C8H19NOS
and a molecular weight of 177.31 g/mol. Its IUPAC name is ethane;3-methyl-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | ethane;3-methyl-1,3-thiazolidin-2-one |
| PubChem CID | 90778752 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | ethane;3-methyl-1,3-thiazolidin-2-one |
| SMILES | CC.CC.CN1CCSC1=O |
| InChI | InChI=1S/C4H7NOS.2C2H6/c1-5-2-3-7-4(5)6;2*1-2/h2-3H2,1H3;2*1-2H3 |
| InChIKey | OBJOHZZZVVOSHS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1,3-thiazolidin-2-one?
The IUPAC name of ethane;3-methyl-1,3-thiazolidin-2-one (CID 90778752) is ethane;3-methyl-1,3-thiazolidin-2-one.
What is the SMILES notation for ethane;3-methyl-1,3-thiazolidin-2-one?
The canonical SMILES for ethane;3-methyl-1,3-thiazolidin-2-one is CC.CC.CN1CCSC1=O.
What is the InChIKey of ethane;3-methyl-1,3-thiazolidin-2-one?
The InChIKey is OBJOHZZZVVOSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS.2C2H6/c1-5-2-3-7-4(5)6;2*1-2/h2-3H2,1H3;2*1-2H3.
What are the key properties of ethane;3-methyl-1,3-thiazolidin-2-one?
ethane;3-methyl-1,3-thiazolidin-2-one has a molecular weight of 177.31 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1,3-thiazolidin-2-one is sourced from PubChem (CID 90778752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).