C13H20N2O3 — CID 90778866
3-[[2,2-bis(methylamino)-3H-1-benzofuran-7-yl]oxy]propan-1-ol (PubChem CID 90778866) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-[[2,2-bis(methylamino)-3H-1-benzofuran-7-yl]oxy]propan-1-ol.
| Compound Name | 3-[[2,2-bis(methylamino)-3H-1-benzofuran-7-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 90778866 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-[[2,2-bis(methylamino)-3H-1-benzofuran-7-yl]oxy]propan-1-ol |
| SMILES | CNC1(NC)Cc2cccc(OCCCO)c2O1 |
| InChI | InChI=1S/C13H20N2O3/c1-14-13(15-2)9-10-5-3-6-11(12(10)18-13)17-8-4-7-16/h3,5-6,14-16H,4,7-9H2,1-2H3 |
| InChIKey | KTORXYQVJUFGCB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|