C23H36OS2Si — CID 90779046
(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)oxy]silane (PubChem CID 90779046) has the molecular formula C23H36OS2Si and a molecular weight of 420.76 g/mol. Its IUPAC name is (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)oxy]silane.
| Compound Name | (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)oxy]silane |
|---|---|
| PubChem CID | 90779046 |
| Molecular Formula | C23H36OS2Si |
| Molecular Weight | 420.76 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-dimethyl-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)oxy]silane |
| SMILES | CC1=CC2C3C=C(C)SC3C([Si](C)(C)OC3C(C)CC4CCCCC43)C2S1 |
| InChI | InChI=1S/C23H36OS2Si/c1-13-10-16-8-6-7-9-17(16)20(13)24-27(4,5)23-21-18(11-14(2)25-21)19-12-15(3)26-22(19)23/h11-13,16-23H,6-10H2,1-5H3 |
| InChIKey | GNYUFXGPDZZKDG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.76 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|