C6H11N5O — CID 90779595
2,3,5,6,7,8-hexahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 90779595) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | 2,3,5,6,7,8-hexahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 90779595 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | NC(=O)C1CN2CNN=C2CN1 |
| InChI | InChI=1S/C6H11N5O/c7-6(12)4-2-11-3-9-10-5(11)1-8-4/h4,8-9H,1-3H2,(H2,7,12) |
| InChIKey | GJQADQRMLBOYLP-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |