C25H32N4O6S — CID 90779954
N-[3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-pyridin-2-ylsulfonylazepan-2-yl]amino]propan-2-yl]furan-2-carboxamide (PubChem CID 90779954) has the molecular formula C25H32N4O6S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-pyridin-2-ylsulfonylazepan-2-yl]amino]propan-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-pyridin-2-ylsulfonylazepan-2-yl]amino]propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 90779954 |
| Molecular Formula | C25H32N4O6S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-pyridin-2-ylsulfonylazepan-2-yl]amino]propan-2-yl]furan-2-carboxamide |
| SMILES | O=C(NC(CC1CCCCC1)C(=O)N[C@@H]1C(=O)CCCCN1S(=O)(=O)c1ccccn1)c1ccco1 |
| InChI | InChI=1S/C25H32N4O6S/c30-20-11-5-7-15-29(36(33,34)22-13-4-6-14-26-22)23(20)28-24(31)19(17-18-9-2-1-3-10-18)27-25(32)21-12-8-16-35-21/h4,6,8,12-14,16,18-19,23H,1-3,5,7,9-11,15,17H2,(H,27,32)(H,28,31)/t19?,23-/m0/s1 |
| InChIKey | UBNLHKNEWKNPQW-BVHINDKJSA-N |
| XLogP | 2.63 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |