About 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid
2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid (PubChem CID 90780025) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid |
| PubChem CID | 90780025 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid |
| SMILES | NCc1ccc(-c2c(O)cc(O)cc2CC(=O)O)o1 |
| InChI | InChI=1S/C13H13NO5/c14-6-9-1-2-11(19-9)13-7(4-12(17)18)3-8(15)5-10(13)16/h1-3,5,15-16H,4,6,14H2,(H,17,18) |
| InChIKey | ZGEATSKMXAWBHW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid?
The IUPAC name of 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid (CID 90780025) is 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid.
What is the SMILES notation for 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid?
The canonical SMILES for 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid is NCc1ccc(-c2c(O)cc(O)cc2CC(=O)O)o1.
What is the InChIKey of 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid?
The InChIKey is ZGEATSKMXAWBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c14-6-9-1-2-11(19-9)13-7(4-12(17)18)3-8(15)5-10(13)16/h1-3,5,15-16H,4,6,14H2,(H,17,18).
What are the key properties of 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid?
2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid has a molecular weight of 263.25 g/mol, XLogP of 1.44, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[5-(aminomethyl)furan-2-yl]-3,5-dihydroxyphenyl]acetic acid is sourced from PubChem (CID 90780025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).