About 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol
2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol (PubChem CID 90780403) has the molecular formula C18H32N2O2SSi
and a molecular weight of 368.62 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol |
| PubChem CID | 90780403 |
| Molecular Formula | C18H32N2O2SSi |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1sc(NC2CC3CCC2C3)nc1O |
| InChI | InChI=1S/C18H32N2O2SSi/c1-18(2,3)24(4,5)22-9-8-15-16(21)20-17(23-15)19-14-11-12-6-7-13(14)10-12/h12-14,21H,6-11H2,1-5H3,(H,19,20) |
| InChIKey | WBTHKPQEURNKAX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol?
The IUPAC name of 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol (CID 90780403) is 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol?
The canonical SMILES for 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol is CC(C)(C)[Si](C)(C)OCCc1sc(NC2CC3CCC2C3)nc1O.
What is the InChIKey of 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol?
The InChIKey is WBTHKPQEURNKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O2SSi/c1-18(2,3)24(4,5)22-9-8-15-16(21)20-17(23-15)19-14-11-12-6-7-13(14)10-12/h12-14,21H,6-11H2,1-5H3,(H,19,20).
What are the key properties of 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol?
2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol has a molecular weight of 368.62 g/mol, XLogP of 5.01, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[2.2.1]heptanylamino)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-4-ol is sourced from PubChem (CID 90780403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).