C27H26ClF3N4O3 — CID 90780425
ethyl (2S)-2-[(2-chloro-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-[2-(trifluoromethyl)imidazo[4,5-c]pyridin-1-yl]phenyl]propanoate (PubChem CID 90780425) has the molecular formula C27H26ClF3N4O3 and a molecular weight of 546.98 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-chloro-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-[2-(trifluoromethyl)imidazo[4,5-c]pyridin-1-yl]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(2-chloro-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-[2-(trifluoromethyl)imidazo[4,5-c]pyridin-1-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 90780425 |
| Molecular Formula | C27H26ClF3N4O3 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | ethyl (2S)-2-[(2-chloro-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-[2-(trifluoromethyl)imidazo[4,5-c]pyridin-1-yl]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(-n2c(C(F)(F)F)nc3cnccc32)cc1)/N=C1\C(Cl)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C27H26ClF3N4O3/c1-2-38-24(37)18(33-22-21(28)23(36)26(22)11-4-3-5-12-26)14-16-6-8-17(9-7-16)35-20-10-13-32-15-19(20)34-25(35)27(29,30)31/h6-10,13,15,18,21H,2-5,11-12,14H2,1H3/b33-22+/t18-,21?/m0/s1 |
| InChIKey | BKVNCXRVROHEOQ-HWIGYESSSA-N |
| XLogP | 5.50 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|