C13H12Cl2FN — CID 90781060
3-butan-2-yl-2,4-dichloro-7-fluoroquinoline (PubChem CID 90781060) has the molecular formula C13H12Cl2FN and a molecular weight of 272.15 g/mol. Its IUPAC name is 3-butan-2-yl-2,4-dichloro-7-fluoroquinoline.
| Compound Name | 3-butan-2-yl-2,4-dichloro-7-fluoroquinoline |
|---|---|
| PubChem CID | 90781060 |
| Molecular Formula | C13H12Cl2FN |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-butan-2-yl-2,4-dichloro-7-fluoroquinoline |
| SMILES | CCC(C)c1c(Cl)nc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C13H12Cl2FN/c1-3-7(2)11-12(14)9-5-4-8(16)6-10(9)17-13(11)15/h4-7H,3H2,1-2H3 |
| InChIKey | SEXYEWVJURLXSC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|