C19H30N2O3 — CID 90781109
tert-butyl 4-methyl-3-oxopiperidine-1-carboxylate;(1R)-1-phenylethanamine (PubChem CID 90781109) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl 4-methyl-3-oxopiperidine-1-carboxylate;(1R)-1-phenylethanamine.
| Compound Name | tert-butyl 4-methyl-3-oxopiperidine-1-carboxylate;(1R)-1-phenylethanamine |
|---|---|
| PubChem CID | 90781109 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl 4-methyl-3-oxopiperidine-1-carboxylate;(1R)-1-phenylethanamine |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)CC1=O.C[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C11H19NO3.C8H11N/c1-8-5-6-12(7-9(8)13)10(14)15-11(2,3)4;1-7(9)8-5-3-2-4-6-8/h8H,5-7H2,1-4H3;2-7H,9H2,1H3/t;7-/m.1/s1 |
| InChIKey | NTFZVSZYLROZKR-HMZWWLAASA-N |
| XLogP | 3.54 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |