C20H16F2N2O4 — CID 90781158
methyl (1S,3S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 90781158) has the molecular formula C20H16F2N2O4 and a molecular weight of 386.35 g/mol. Its IUPAC name is methyl (1S,3S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 90781158 |
| Molecular Formula | C20H16F2N2O4 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | methyl (1S,3S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc3c(c2)OC(F)(F)O3)N1 |
| InChI | InChI=1S/C20H16F2N2O4/c1-26-19(25)14-9-12-11-4-2-3-5-13(11)23-18(12)17(24-14)10-6-7-15-16(8-10)28-20(21,22)27-15/h2-8,14,17,23-24H,9H2,1H3/t14-,17-/m0/s1 |
| InChIKey | OAJAZQDFDSYYCZ-YOEHRIQHSA-N |
| XLogP | 3.27 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|