C31H45FN2O5SSi — CID 90781374
[(1R,2R,3R,4R)-3-[(R)-[2-[3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-5-fluorophenyl]-(imidazole-1-carbothioyloxy)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate (PubChem CID 90781374) has the molecular formula C31H45FN2O5SSi and a molecular weight of 604.86 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-3-[(R)-[2-[3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-5-fluorophenyl]-(imidazole-1-carbothioyloxy)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate.
| Compound Name | [(1R,2R,3R,4R)-3-[(R)-[2-[3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-5-fluorophenyl]-(imidazole-1-carbothioyloxy)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90781374 |
| Molecular Formula | C31H45FN2O5SSi |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | [(1R,2R,3R,4R)-3-[(R)-[2-[3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-5-fluorophenyl]-(imidazole-1-carbothioyloxy)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H]([C@@H](OC(=S)n2ccnc2)c2cc(F)ccc2CCCO[Si](C)(C)C(C)(C)C(C)C)[C@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C31H45FN2O5SSi/c1-20(2)31(4,5)41(6,7)37-16-8-9-22-10-11-23(32)17-24(22)29(39-30(40)34-15-14-33-19-34)28-25(18-36-21(3)35)26-12-13-27(28)38-26/h10-11,14-15,17,19-20,25-29H,8-9,12-13,16,18H2,1-7H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | NQHZTPFKMSLZOD-JPHCZMGXSA-N |
| XLogP | 6.86 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|