C20H38O — CID 90782124
6-ethyl-3,3,5,5,6,10,10-heptamethylundec-7-en-2-one (PubChem CID 90782124) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is 6-ethyl-3,3,5,5,6,10,10-heptamethylundec-7-en-2-one.
| Compound Name | 6-ethyl-3,3,5,5,6,10,10-heptamethylundec-7-en-2-one |
|---|---|
| PubChem CID | 90782124 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 6-ethyl-3,3,5,5,6,10,10-heptamethylundec-7-en-2-one |
| SMILES | CCC(C)(C=CCC(C)(C)C)C(C)(C)CC(C)(C)C(C)=O |
| InChI | InChI=1S/C20H38O/c1-11-20(10,14-12-13-17(3,4)5)19(8,9)15-18(6,7)16(2)21/h12,14H,11,13,15H2,1-10H3 |
| InChIKey | FDYYKSCRFQQRTR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|