C18H26O2 — CID 90782257
4-[1-(2,5-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1-ethylcyclopent-2-ene-1-carboxylic acid (PubChem CID 90782257) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 4-[1-(2,5-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1-ethylcyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[1-(2,5-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1-ethylcyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 90782257 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 4-[1-(2,5-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1-ethylcyclopent-2-ene-1-carboxylic acid |
| SMILES | CCC1(C(=O)O)C=CC(C(C)C2CC(C)=CC=C2C)C1 |
| InChI | InChI=1S/C18H26O2/c1-5-18(17(19)20)9-8-15(11-18)14(4)16-10-12(2)6-7-13(16)3/h6-9,14-16H,5,10-11H2,1-4H3,(H,19,20) |
| InChIKey | ONPUWOLTMODANH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|