C12H22N4 — CID 90782623
N,3,5-trimethyl-4-(1-methyliminobut-2-en-2-yl)-2,6-dihydro-1H-pyrimidin-6-amine (PubChem CID 90782623) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N,3,5-trimethyl-4-(1-methyliminobut-2-en-2-yl)-2,6-dihydro-1H-pyrimidin-6-amine.
| Compound Name | N,3,5-trimethyl-4-(1-methyliminobut-2-en-2-yl)-2,6-dihydro-1H-pyrimidin-6-amine |
|---|---|
| PubChem CID | 90782623 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N,3,5-trimethyl-4-(1-methyliminobut-2-en-2-yl)-2,6-dihydro-1H-pyrimidin-6-amine |
| SMILES | CC=C(/C=N/C)C1=C(C)C(NC)NCN1C |
| InChI | InChI=1S/C12H22N4/c1-6-10(7-13-3)11-9(2)12(14-4)15-8-16(11)5/h6-7,12,14-15H,8H2,1-5H3/b10-6?,13-7+ |
| InChIKey | BQHYPEBITCNADE-XNPQEMJOSA-N |
| XLogP | 0.95 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|