C29H54N2O2 — CID 90782781
1-[3-(dimethylamino)propyl]-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrole-2,5-diol (PubChem CID 90782781) has the molecular formula C29H54N2O2 and a molecular weight of 462.76 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrole-2,5-diol.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90782781 |
| Molecular Formula | C29H54N2O2 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.42 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrole-2,5-diol |
| SMILES | C=C(C)C(c1cc(O)n(CCCN(C)C)c1O)C(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C29H54N2O2/c1-21(2)24(22-17-23(32)31(25(22)33)16-14-15-30(12)13)29(10,11)20-28(8,9)19-27(6,7)18-26(3,4)5/h17,24,32-33H,1,14-16,18-20H2,2-13H3 |
| InChIKey | SJZCLVRHTRKBTJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|