C27H40O7 — CID 90782918
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] octadeca-9,12,15-trienoate (PubChem CID 90782918) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] octadeca-9,12,15-trienoate.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 90782918 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] octadeca-9,12,15-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OC1C(=O)OC(C2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C27H40O7/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(28)32-25-23(29)24(33-26(25)30)21-20-31-27(2,3)34-21/h5-6,8-9,11-12,21,24-25H,4,7,10,13-20H2,1-3H3 |
| InChIKey | YZNVFBFHXZHXNN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|