C15H12F3NO3 — CID 90783164
(4R,7S)-2-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 90783164) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is (4R,7S)-2-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (4R,7S)-2-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90783164 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (4R,7S)-2-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1cccc(C(F)(F)F)c1)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C15H12F3NO3/c16-15(17,18)7-2-1-3-8(6-7)19-13(20)11-9-4-5-10(22-9)12(11)14(19)21/h1-3,6,9-10,20-21H,4-5H2/t9-,10+ |
| InChIKey | LMAMWPCMUXSKIX-AOOOYVTPSA-N |
| XLogP | 3.81 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |