C28H30F2O5S — CID 90783483
(8S,9R,10S,11S,13S,14S,16R,17R)-17-benzoyloxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 90783483) has the molecular formula C28H30F2O5S and a molecular weight of 516.61 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16R,17R)-17-benzoyloxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9R,10S,11S,13S,14S,16R,17R)-17-benzoyloxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 90783483 |
| Molecular Formula | C28H30F2O5S |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16R,17R)-17-benzoyloxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CC(F)=C4CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)c1ccccc1)C(=O)S |
| InChI | InChI=1S/C28H30F2O5S/c1-15-11-18-19-13-21(29)20-12-17(31)9-10-25(20,2)27(19,30)22(32)14-26(18,3)28(15,24(34)36)35-23(33)16-7-5-4-6-8-16/h4-10,15,18-19,22,32H,11-14H2,1-3H3,(H,34,36)/t15-,18+,19+,22+,25+,26+,27+,28+/m1/s1 |
| InChIKey | NGSXFSKUFJGISF-WBMDHEOCSA-N |
| XLogP | 4.95 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|