C41H43FN4O6S2 — CID 90783739
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-5-fluoro-3-methyl-1-benzothiophene-2-sulfonamide (PubChem CID 90783739) has the molecular formula C41H43FN4O6S2 and a molecular weight of 770.95 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-5-fluoro-3-methyl-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-5-fluoro-3-methyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90783739 |
| Molecular Formula | C41H43FN4O6S2 |
| Molecular Weight | 770.95 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-5-fluoro-3-methyl-1-benzothiophene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2sc3ccc(F)cc3c2C)N2C(=O)c3cccc(N4CCN(C(C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C41H43FN4O6S2/c1-26-32-25-30(42)16-18-37(32)53-41(26)54(49,50)43-19-9-14-33(29-15-17-35(51-3)36(24-29)52-4)46-39(47)31-12-8-13-34(38(31)40(46)48)45-22-20-44(21-23-45)27(2)28-10-6-5-7-11-28/h5-8,10-13,15-18,24-25,27,33,43H,9,14,19-23H2,1-4H3/t27?,33-/m1/s1 |
| InChIKey | GBBWDBVWNAXIFR-WUWQCRANSA-N |
| XLogP | 7.35 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.95 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|