C16H17N7O3 — CID 9078398
2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide (PubChem CID 9078398) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide.
| Compound Name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9078398 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide |
| SMILES | Cc1nc2ncnn2c(C)c1CC(=O)NNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C16H17N7O3/c1-10-12(11(2)23-16(19-10)17-9-18-23)7-13(24)20-21-14(25)8-22-6-4-3-5-15(22)26/h3-6,9H,7-8H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | ZXQUDGSSZWLIFL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|