C18H20N4OS — CID 90784045
5-[3-[(4-ethoxyanilino)methyl]-4-methylphenyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 90784045) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 5-[3-[(4-ethoxyanilino)methyl]-4-methylphenyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[3-[(4-ethoxyanilino)methyl]-4-methylphenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 90784045 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 5-[3-[(4-ethoxyanilino)methyl]-4-methylphenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCOc1ccc(NCc2cc(-c3nc(=S)[nH][nH]3)ccc2C)cc1 |
| InChI | InChI=1S/C18H20N4OS/c1-3-23-16-8-6-15(7-9-16)19-11-14-10-13(5-4-12(14)2)17-20-18(24)22-21-17/h4-10,19H,3,11H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | WWVXCOCFMPZDTD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|