C30H29F3N4O6S — CID 90784145
ethyl 3-[N-[4-[methylsulfonyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 90784145) has the molecular formula C30H29F3N4O6S and a molecular weight of 630.65 g/mol. Its IUPAC name is ethyl 3-[N-[4-[methylsulfonyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | ethyl 3-[N-[4-[methylsulfonyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90784145 |
| Molecular Formula | C30H29F3N4O6S |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | ethyl 3-[N-[4-[methylsulfonyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(N(CCCNC(=O)C(F)(F)F)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H29F3N4O6S/c1-3-43-28(39)20-10-15-23-24(18-20)36-27(38)25(23)26(19-8-5-4-6-9-19)35-21-11-13-22(14-12-21)37(44(2,41)42)17-7-16-34-29(40)30(31,32)33/h4-6,8-15,18,25H,3,7,16-17H2,1-2H3,(H,34,40)(H,36,38)/b35-26+ |
| InChIKey | KKBPUVZTGCFSLJ-MDAYZVFASA-N |
| XLogP | 4.55 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|