About 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine
5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine (PubChem CID 90784227) has the molecular formula C19H19N5
and a molecular weight of 317.40 g/mol. Its IUPAC name is 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine |
| PubChem CID | 90784227 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine |
| SMILES | Cc1cc(N)c(Nc2ccccc2/N=N\c2ccccc2)cc1N |
| InChI | InChI=1S/C19H19N5/c1-13-11-16(21)19(12-15(13)20)22-17-9-5-6-10-18(17)24-23-14-7-3-2-4-8-14/h2-12,22H,20-21H2,1H3/b24-23- |
| InChIKey | QCBJLQAFUNUVQP-VHXPQNKSSA-N |
| XLogP | 5.32 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine?
The IUPAC name of 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine (CID 90784227) is 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine.
What is the SMILES notation for 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine?
The canonical SMILES for 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine is Cc1cc(N)c(Nc2ccccc2/N=N\c2ccccc2)cc1N.
What is the InChIKey of 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine?
The InChIKey is QCBJLQAFUNUVQP-VHXPQNKSSA-N. The full InChI is InChI=1S/C19H19N5/c1-13-11-16(21)19(12-15(13)20)22-17-9-5-6-10-18(17)24-23-14-7-3-2-4-8-14/h2-12,22H,20-21H2,1H3/b24-23-.
What are the key properties of 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine?
5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine has a molecular weight of 317.40 g/mol, XLogP of 5.32, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-N-(2-phenyldiazenylphenyl)benzene-1,2,4-triamine is sourced from PubChem (CID 90784227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).