C25H33N3O6S — CID 90784287
methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.2.2.14,7]henicosa-1(19),14,16(20),17-tetraene-6-carboxylate (PubChem CID 90784287) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.2.2.14,7]henicosa-1(19),14,16(20),17-tetraene-6-carboxylate.
| Compound Name | methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.2.2.14,7]henicosa-1(19),14,16(20),17-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 90784287 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.2.2.14,7]henicosa-1(19),14,16(20),17-tetraene-6-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)C(C1CCCCC1)NC(=O)CCC=Cc1ccc(cc1)S(=O)(=O)N2 |
| InChI | InChI=1S/C25H33N3O6S/c1-34-25(31)21-15-19-16-28(21)24(30)23(18-8-3-2-4-9-18)26-22(29)10-6-5-7-17-11-13-20(14-12-17)35(32,33)27-19/h5,7,11-14,18-19,21,23,27H,2-4,6,8-10,15-16H2,1H3,(H,26,29)/t19-,21?,23?/m1/s1 |
| InChIKey | VLRIXEBBUGUFNS-VWRAKTAISA-N |
| XLogP | 1.98 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |