C11H20N2 — CID 90785164
2,3,3a,4a,5,6,7,8,8a,8b-decahydro-1H-cyclopenta[b]indol-4-amine (PubChem CID 90785164) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,3,3a,4a,5,6,7,8,8a,8b-decahydro-1H-cyclopenta[b]indol-4-amine.
| Compound Name | 2,3,3a,4a,5,6,7,8,8a,8b-decahydro-1H-cyclopenta[b]indol-4-amine |
|---|---|
| PubChem CID | 90785164 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2,3,3a,4a,5,6,7,8,8a,8b-decahydro-1H-cyclopenta[b]indol-4-amine |
| SMILES | NN1C2CCCCC2C2CCCC21 |
| InChI | InChI=1S/C11H20N2/c12-13-10-6-2-1-4-8(10)9-5-3-7-11(9)13/h8-11H,1-7,12H2 |
| InChIKey | AXJVHWBTTSQENH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|